C19H23BrN2O — CID 176508387
(3S)-1-[(4-bromo-3-phenylmethoxyphenyl)methyl]-3-methylpiperazine (PubChem CID 176508387) has the molecular formula C19H23BrN2O and a molecular weight of 375.31 g/mol. Its IUPAC name is (3S)-1-[(4-bromo-3-phenylmethoxyphenyl)methyl]-3-methylpiperazine.
| Compound Name | (3S)-1-[(4-bromo-3-phenylmethoxyphenyl)methyl]-3-methylpiperazine |
|---|---|
| PubChem CID | 176508387 |
| Molecular Formula | C19H23BrN2O |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | (3S)-1-[(4-bromo-3-phenylmethoxyphenyl)methyl]-3-methylpiperazine |
| SMILES | C[C@H]1CN(Cc2ccc(Br)c(OCc3ccccc3)c2)CCN1 |
| InChI | InChI=1S/C19H23BrN2O/c1-15-12-22(10-9-21-15)13-17-7-8-18(20)19(11-17)23-14-16-5-3-2-4-6-16/h2-8,11,15,21H,9-10,12-14H2,1H3/t15-/m0/s1 |
| InChIKey | QOLIASGSRZNDQM-HNNXBMFYSA-N |
| XLogP | 3.82 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |