About 2-(4-bromo-2,6-dimethylphenyl)-6-(3-fluoro-4-pyridinyl)-5H-pyrazolo[3,4-d]pyrimidin-4-one
2-(4-bromo-2,6-dimethylphenyl)-6-(3-fluoro-4-pyridinyl)-5H-pyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 176509244) has the molecular formula C18H13BrFN5O
and a molecular weight of 414.24 g/mol. Its IUPAC name is 2-(4-bromo-2,6-dimethylphenyl)-6-(3-fluoro-4-pyridinyl)-5H-pyrazolo[3,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-(4-bromo-2,6-dimethylphenyl)-6-(3-fluoro-4-pyridinyl)-5H-pyrazolo[3,4-d]pyrimidin-4-one |
| PubChem CID | 176509244 |
| Molecular Formula | C18H13BrFN5O |
| Molecular Weight | 414.24 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | 2-(4-bromo-2,6-dimethylphenyl)-6-(3-fluoro-4-pyridinyl)-5H-pyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | Cc1cc(Br)cc(C)c1-n1cc2c(=O)[nH]c(-c3ccncc3F)nc2n1 |
| InChI | InChI=1S/C18H13BrFN5O/c1-9-5-11(19)6-10(2)15(9)25-8-13-17(24-25)22-16(23-18(13)26)12-3-4-21-7-14(12)20/h3-8H,1-2H3,(H,22,23,24,26) |
| InChIKey | SBEMRVQHFJUQCH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.24 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-bromo-2,6-dimethylphenyl)-6-(3-fluoro-4-pyridinyl)-5H-pyrazolo[3,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromo-2,6-dimethylphenyl)-6-(3-fluoro-4-pyridinyl)-5H-pyrazolo[3,4-d]pyrimidin-4-one?
The IUPAC name of 2-(4-bromo-2,6-dimethylphenyl)-6-(3-fluoro-4-pyridinyl)-5H-pyrazolo[3,4-d]pyrimidin-4-one (CID 176509244) is 2-(4-bromo-2,6-dimethylphenyl)-6-(3-fluoro-4-pyridinyl)-5H-pyrazolo[3,4-d]pyrimidin-4-one.
What is the SMILES notation for 2-(4-bromo-2,6-dimethylphenyl)-6-(3-fluoro-4-pyridinyl)-5H-pyrazolo[3,4-d]pyrimidin-4-one?
The canonical SMILES for 2-(4-bromo-2,6-dimethylphenyl)-6-(3-fluoro-4-pyridinyl)-5H-pyrazolo[3,4-d]pyrimidin-4-one is Cc1cc(Br)cc(C)c1-n1cc2c(=O)[nH]c(-c3ccncc3F)nc2n1.
What is the InChIKey of 2-(4-bromo-2,6-dimethylphenyl)-6-(3-fluoro-4-pyridinyl)-5H-pyrazolo[3,4-d]pyrimidin-4-one?
The InChIKey is SBEMRVQHFJUQCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13BrFN5O/c1-9-5-11(19)6-10(2)15(9)25-8-13-17(24-25)22-16(23-18(13)26)12-3-4-21-7-14(12)20/h3-8H,1-2H3,(H,22,23,24,26).
What are the key properties of 2-(4-bromo-2,6-dimethylphenyl)-6-(3-fluoro-4-pyridinyl)-5H-pyrazolo[3,4-d]pyrimidin-4-one?
2-(4-bromo-2,6-dimethylphenyl)-6-(3-fluoro-4-pyridinyl)-5H-pyrazolo[3,4-d]pyrimidin-4-one has a molecular weight of 414.24 g/mol, XLogP of 3.69, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-2,6-dimethylphenyl)-6-(3-fluoro-4-pyridinyl)-5H-pyrazolo[3,4-d]pyrimidin-4-one is sourced from PubChem (CID 176509244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).