C35H39ClN8O5 — CID 176509272
methyl (2S)-2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]-3-(4-hydroxyphenyl)propanoate (PubChem CID 176509272) has the molecular formula C35H39ClN8O5 and a molecular weight of 687.20 g/mol. Its IUPAC name is methyl (2S)-2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]-3-(4-hydroxyphenyl)propanoate.
| Compound Name | methyl (2S)-2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 176509272 |
| Molecular Formula | C35H39ClN8O5 |
| Molecular Weight | 687.20 g/mol |
| Exact Mass | 686.27 |
| IUPAC Name | methyl (2S)-2-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoylamino]-3-(4-hydroxyphenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CCc1ccc(-c2ccc(CCCC/N=C(\N)NC(=O)c3nc(Cl)c(N)nc3N)cc2)cc1 |
| InChI | InChI=1S/C35H39ClN8O5/c1-49-34(48)27(20-23-9-16-26(45)17-10-23)41-28(46)18-11-22-7-14-25(15-8-22)24-12-5-21(6-13-24)4-2-3-19-40-35(39)44-33(47)29-31(37)43-32(38)30(36)42-29/h5-10,12-17,27,45H,2-4,11,18-20H2,1H3,(H,41,46)(H4,37,38,43)(H3,39,40,44,47)/t27-/m0/s1 |
| InChIKey | PAXDDARPCMDSSD-MHZLTWQESA-N |
| XLogP | 3.57 |
| TPSA | 220.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.20 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|