C33H43ClN10O4 — CID 176509301
(2S)-1-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoyl]-4-(3-aminopropyl)piperazine-2-carboxylic acid (PubChem CID 176509301) has the molecular formula C33H43ClN10O4 and a molecular weight of 679.23 g/mol. Its IUPAC name is (2S)-1-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoyl]-4-(3-aminopropyl)piperazine-2-carboxylic acid.
| Compound Name | (2S)-1-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoyl]-4-(3-aminopropyl)piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 176509301 |
| Molecular Formula | C33H43ClN10O4 |
| Molecular Weight | 679.23 g/mol |
| Exact Mass | 678.32 |
| IUPAC Name | (2S)-1-[3-[4-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]phenyl]propanoyl]-4-(3-aminopropyl)piperazine-2-carboxylic acid |
| SMILES | NCCCN1CCN(C(=O)CCc2ccc(-c3ccc(CCCC/N=C(\N)NC(=O)c4nc(Cl)c(N)nc4N)cc3)cc2)[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C33H43ClN10O4/c34-28-30(37)41-29(36)27(40-28)31(46)42-33(38)39-16-2-1-4-21-5-10-23(11-6-21)24-12-7-22(8-13-24)9-14-26(45)44-19-18-43(17-3-15-35)20-25(44)32(47)48/h5-8,10-13,25H,1-4,9,14-20,35H2,(H,47,48)(H4,36,37,41)(H3,38,39,42,46)/t25-/m0/s1 |
| InChIKey | YUYKGMBKXQSUCH-VWLOTQADSA-N |
| XLogP | 1.91 |
| TPSA | 232.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|