About N-ethyl-N-[1-(4-fluorophenyl)ethyl]-1,3-thiazole-2-sulfonamide
N-ethyl-N-[1-(4-fluorophenyl)ethyl]-1,3-thiazole-2-sulfonamide (PubChem CID 176509340) has the molecular formula C13H15FN2O2S2
and a molecular weight of 314.41 g/mol. Its IUPAC name is N-ethyl-N-[1-(4-fluorophenyl)ethyl]-1,3-thiazole-2-sulfonamide.
Molecular Properties
| Compound Name | N-ethyl-N-[1-(4-fluorophenyl)ethyl]-1,3-thiazole-2-sulfonamide |
| PubChem CID | 176509340 |
| Molecular Formula | C13H15FN2O2S2 |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | N-ethyl-N-[1-(4-fluorophenyl)ethyl]-1,3-thiazole-2-sulfonamide |
| SMILES | CCN(C(C)c1ccc(F)cc1)S(=O)(=O)c1nccs1 |
| InChI | InChI=1S/C13H15FN2O2S2/c1-3-16(20(17,18)13-15-8-9-19-13)10(2)11-4-6-12(14)7-5-11/h4-10H,3H2,1-2H3 |
| InChIKey | JYGMAJZQWYFHKS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-N-[1-(4-fluorophenyl)ethyl]-1,3-thiazole-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-[1-(4-fluorophenyl)ethyl]-1,3-thiazole-2-sulfonamide?
The IUPAC name of N-ethyl-N-[1-(4-fluorophenyl)ethyl]-1,3-thiazole-2-sulfonamide (CID 176509340) is N-ethyl-N-[1-(4-fluorophenyl)ethyl]-1,3-thiazole-2-sulfonamide.
What is the SMILES notation for N-ethyl-N-[1-(4-fluorophenyl)ethyl]-1,3-thiazole-2-sulfonamide?
The canonical SMILES for N-ethyl-N-[1-(4-fluorophenyl)ethyl]-1,3-thiazole-2-sulfonamide is CCN(C(C)c1ccc(F)cc1)S(=O)(=O)c1nccs1.
What is the InChIKey of N-ethyl-N-[1-(4-fluorophenyl)ethyl]-1,3-thiazole-2-sulfonamide?
The InChIKey is JYGMAJZQWYFHKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FN2O2S2/c1-3-16(20(17,18)13-15-8-9-19-13)10(2)11-4-6-12(14)7-5-11/h4-10H,3H2,1-2H3.
What are the key properties of N-ethyl-N-[1-(4-fluorophenyl)ethyl]-1,3-thiazole-2-sulfonamide?
N-ethyl-N-[1-(4-fluorophenyl)ethyl]-1,3-thiazole-2-sulfonamide has a molecular weight of 314.41 g/mol, XLogP of 3.05, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-[1-(4-fluorophenyl)ethyl]-1,3-thiazole-2-sulfonamide is sourced from PubChem (CID 176509340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).