About N-ethyl-N-[(1S)-1-(4-fluorophenyl)ethyl]-[1,3]thiazolo[4,5-b]pyridine-6-sulfonamide
N-ethyl-N-[(1S)-1-(4-fluorophenyl)ethyl]-[1,3]thiazolo[4,5-b]pyridine-6-sulfonamide (PubChem CID 176509368) has the molecular formula C16H16FN3O2S2
and a molecular weight of 365.46 g/mol. Its IUPAC name is N-ethyl-N-[(1S)-1-(4-fluorophenyl)ethyl]-[1,3]thiazolo[4,5-b]pyridine-6-sulfonamide.
Molecular Properties
| Compound Name | N-ethyl-N-[(1S)-1-(4-fluorophenyl)ethyl]-[1,3]thiazolo[4,5-b]pyridine-6-sulfonamide |
| PubChem CID | 176509368 |
| Molecular Formula | C16H16FN3O2S2 |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N-ethyl-N-[(1S)-1-(4-fluorophenyl)ethyl]-[1,3]thiazolo[4,5-b]pyridine-6-sulfonamide |
| SMILES | CCN([C@@H](C)c1ccc(F)cc1)S(=O)(=O)c1cnc2ncsc2c1 |
| InChI | InChI=1S/C16H16FN3O2S2/c1-3-20(11(2)12-4-6-13(17)7-5-12)24(21,22)14-8-15-16(18-9-14)19-10-23-15/h4-11H,3H2,1-2H3/t11-/m0/s1 |
| InChIKey | PBVRAVYEUAEMIQ-NSHDSACASA-N |
| XLogP | 3.60 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-ethyl-N-[(1S)-1-(4-fluorophenyl)ethyl]-[1,3]thiazolo[4,5-b]pyridine-6-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-[(1S)-1-(4-fluorophenyl)ethyl]-[1,3]thiazolo[4,5-b]pyridine-6-sulfonamide?
The IUPAC name of N-ethyl-N-[(1S)-1-(4-fluorophenyl)ethyl]-[1,3]thiazolo[4,5-b]pyridine-6-sulfonamide (CID 176509368) is N-ethyl-N-[(1S)-1-(4-fluorophenyl)ethyl]-[1,3]thiazolo[4,5-b]pyridine-6-sulfonamide.
What is the SMILES notation for N-ethyl-N-[(1S)-1-(4-fluorophenyl)ethyl]-[1,3]thiazolo[4,5-b]pyridine-6-sulfonamide?
The canonical SMILES for N-ethyl-N-[(1S)-1-(4-fluorophenyl)ethyl]-[1,3]thiazolo[4,5-b]pyridine-6-sulfonamide is CCN([C@@H](C)c1ccc(F)cc1)S(=O)(=O)c1cnc2ncsc2c1.
What is the InChIKey of N-ethyl-N-[(1S)-1-(4-fluorophenyl)ethyl]-[1,3]thiazolo[4,5-b]pyridine-6-sulfonamide?
The InChIKey is PBVRAVYEUAEMIQ-NSHDSACASA-N. The full InChI is InChI=1S/C16H16FN3O2S2/c1-3-20(11(2)12-4-6-13(17)7-5-12)24(21,22)14-8-15-16(18-9-14)19-10-23-15/h4-11H,3H2,1-2H3/t11-/m0/s1.
What are the key properties of N-ethyl-N-[(1S)-1-(4-fluorophenyl)ethyl]-[1,3]thiazolo[4,5-b]pyridine-6-sulfonamide?
N-ethyl-N-[(1S)-1-(4-fluorophenyl)ethyl]-[1,3]thiazolo[4,5-b]pyridine-6-sulfonamide has a molecular weight of 365.46 g/mol, XLogP of 3.60, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-[(1S)-1-(4-fluorophenyl)ethyl]-[1,3]thiazolo[4,5-b]pyridine-6-sulfonamide is sourced from PubChem (CID 176509368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).