C31H33FN8O2 — CID 176511555
1-[(3R)-3-[[5-(4-fluorobenzoyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 176511555) has the molecular formula C31H33FN8O2 and a molecular weight of 568.66 g/mol. Its IUPAC name is 1-[(3R)-3-[[5-(4-fluorobenzoyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[[5-(4-fluorobenzoyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 176511555 |
| Molecular Formula | C31H33FN8O2 |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | 1-[(3R)-3-[[5-(4-fluorobenzoyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC[C@@H](Nc2nc(Nc3ccc(N4CCN(C)CC4)cc3)nc3[nH]cc(C(=O)c4ccc(F)cc4)c23)C1 |
| InChI | InChI=1S/C31H33FN8O2/c1-3-26(41)40-13-12-23(19-40)34-30-27-25(28(42)20-4-6-21(32)7-5-20)18-33-29(27)36-31(37-30)35-22-8-10-24(11-9-22)39-16-14-38(2)15-17-39/h3-11,18,23H,1,12-17,19H2,2H3,(H3,33,34,35,36,37)/t23-/m1/s1 |
| InChIKey | UMNFGEIPPQRURT-HSZRJFAPSA-N |
| XLogP | 4.02 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|