C25H27BN4O3 — CID 176513773
3,5-dimethyl-4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]pyrimidin-4-yl]oxybenzonitrile (PubChem CID 176513773) has the molecular formula C25H27BN4O3 and a molecular weight of 442.33 g/mol. Its IUPAC name is 3,5-dimethyl-4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]pyrimidin-4-yl]oxybenzonitrile.
| Compound Name | 3,5-dimethyl-4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]pyrimidin-4-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 176513773 |
| Molecular Formula | C25H27BN4O3 |
| Molecular Weight | 442.33 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 3,5-dimethyl-4-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]pyrimidin-4-yl]oxybenzonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1Oc1ccnc(Nc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)n1 |
| InChI | InChI=1S/C25H27BN4O3/c1-16-13-18(15-27)14-17(2)22(16)31-21-11-12-28-23(30-21)29-20-9-7-19(8-10-20)26-32-24(3,4)25(5,6)33-26/h7-14H,1-6H3,(H,28,29,30) |
| InChIKey | XPTXTKRBCPOKDC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 89.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.33 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|