C14H18O6 — CID 176514072
6-[(3aR,4S,6R)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]cyclohex-4-ene-1,3-dione (PubChem CID 176514072) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is 6-[(3aR,4S,6R)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]cyclohex-4-ene-1,3-dione.
| Compound Name | 6-[(3aR,4S,6R)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]cyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 176514072 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 6-[(3aR,4S,6R)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]cyclohex-4-ene-1,3-dione |
| SMILES | CC1(C)OC2[C@@H](CO)O[C@@H](C3C=CC(=O)CC3=O)[C@H]2O1 |
| InChI | InChI=1S/C14H18O6/c1-14(2)19-12-10(6-15)18-11(13(12)20-14)8-4-3-7(16)5-9(8)17/h3-4,8,10-13,15H,5-6H2,1-2H3/t8?,10-,11+,12?,13-/m1/s1 |
| InChIKey | YUMMQSNJBHDWHY-GJCHWOHRSA-N |
| XLogP | -0.02 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|