C17H26N2O5 — CID 176514215
(2S,3aR,7aS)-1-[(2S)-2-[[(1S)-1-carboxybutyl]amino]propanoyl]-2,3,3a,6,7,7a-hexahydroindole-2-carboxylic acid (PubChem CID 176514215) has the molecular formula C17H26N2O5 and a molecular weight of 338.40 g/mol. Its IUPAC name is (2S,3aR,7aS)-1-[(2S)-2-[[(1S)-1-carboxybutyl]amino]propanoyl]-2,3,3a,6,7,7a-hexahydroindole-2-carboxylic acid.
| Compound Name | (2S,3aR,7aS)-1-[(2S)-2-[[(1S)-1-carboxybutyl]amino]propanoyl]-2,3,3a,6,7,7a-hexahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 176514215 |
| Molecular Formula | C17H26N2O5 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (2S,3aR,7aS)-1-[(2S)-2-[[(1S)-1-carboxybutyl]amino]propanoyl]-2,3,3a,6,7,7a-hexahydroindole-2-carboxylic acid |
| SMILES | CCC[C@H](N[C@@H](C)C(=O)N1[C@H](C(=O)O)C[C@@H]2C=CCC[C@@H]21)C(=O)O |
| InChI | InChI=1S/C17H26N2O5/c1-3-6-12(16(21)22)18-10(2)15(20)19-13-8-5-4-7-11(13)9-14(19)17(23)24/h4,7,10-14,18H,3,5-6,8-9H2,1-2H3,(H,21,22)(H,23,24)/t10-,11-,12-,13-,14-/m0/s1 |
| InChIKey | AOQNRJQXUCSDIT-PEDHHIEDSA-N |
| XLogP | 1.24 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|