C17H15F3O3 — CID 176514248
2-methyl-2-[3-[3-(trifluoromethoxy)phenyl]phenyl]propanoic acid (PubChem CID 176514248) has the molecular formula C17H15F3O3 and a molecular weight of 324.30 g/mol. Its IUPAC name is 2-methyl-2-[3-[3-(trifluoromethoxy)phenyl]phenyl]propanoic acid.
| Compound Name | 2-methyl-2-[3-[3-(trifluoromethoxy)phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 176514248 |
| Molecular Formula | C17H15F3O3 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 2-methyl-2-[3-[3-(trifluoromethoxy)phenyl]phenyl]propanoic acid |
| SMILES | CC(C)(C(=O)O)c1cccc(-c2cccc(OC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C17H15F3O3/c1-16(2,15(21)22)13-7-3-5-11(9-13)12-6-4-8-14(10-12)23-17(18,19)20/h3-10H,1-2H3,(H,21,22) |
| InChIKey | BANAHDBUUQPXBF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |