C16H9F26NO4S2 — CID 176514729
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)octane-1-sulfonamide (PubChem CID 176514729) has the molecular formula C16H9F26NO4S2 and a molecular weight of 837.33 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)octane-1-sulfonamide.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)octane-1-sulfonamide |
|---|---|
| PubChem CID | 176514729 |
| Molecular Formula | C16H9F26NO4S2 |
| Molecular Weight | 837.33 g/mol |
| Exact Mass | 836.96 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-N-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfonyl)octane-1-sulfonamide |
| SMILES | O=S(=O)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)NS(=O)(=O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H9F26NO4S2/c17-5(18,7(21,22)9(25,26)11(29,30)13(33,34)15(37,38)39)1-3-48(44,45)43-49(46,47)4-2-6(19,20)8(23,24)10(27,28)12(31,32)14(35,36)16(40,41)42/h43H,1-4H2 |
| InChIKey | GNXKIANWUOJVLQ-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.33 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|