About 6-[[2,3-difluoro-5-[2-(methylamino)ethyl]phenoxy]methyl]-4-methylpyridin-2-amine
6-[[2,3-difluoro-5-[2-(methylamino)ethyl]phenoxy]methyl]-4-methylpyridin-2-amine (PubChem CID 176515337) has the molecular formula C16H19F2N3O
and a molecular weight of 307.34 g/mol. Its IUPAC name is 6-[[2,3-difluoro-5-[2-(methylamino)ethyl]phenoxy]methyl]-4-methylpyridin-2-amine.
Molecular Properties
| Compound Name | 6-[[2,3-difluoro-5-[2-(methylamino)ethyl]phenoxy]methyl]-4-methylpyridin-2-amine |
| PubChem CID | 176515337 |
| Molecular Formula | C16H19F2N3O |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 6-[[2,3-difluoro-5-[2-(methylamino)ethyl]phenoxy]methyl]-4-methylpyridin-2-amine |
| SMILES | CNCCc1cc(F)c(F)c(OCc2cc(C)cc(N)n2)c1 |
| InChI | InChI=1S/C16H19F2N3O/c1-10-5-12(21-15(19)6-10)9-22-14-8-11(3-4-20-2)7-13(17)16(14)18/h5-8,20H,3-4,9H2,1-2H3,(H2,19,21) |
| InChIKey | ZZDNZFBZKZFPJU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[[2,3-difluoro-5-[2-(methylamino)ethyl]phenoxy]methyl]-4-methylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[2,3-difluoro-5-[2-(methylamino)ethyl]phenoxy]methyl]-4-methylpyridin-2-amine?
The IUPAC name of 6-[[2,3-difluoro-5-[2-(methylamino)ethyl]phenoxy]methyl]-4-methylpyridin-2-amine (CID 176515337) is 6-[[2,3-difluoro-5-[2-(methylamino)ethyl]phenoxy]methyl]-4-methylpyridin-2-amine.
What is the SMILES notation for 6-[[2,3-difluoro-5-[2-(methylamino)ethyl]phenoxy]methyl]-4-methylpyridin-2-amine?
The canonical SMILES for 6-[[2,3-difluoro-5-[2-(methylamino)ethyl]phenoxy]methyl]-4-methylpyridin-2-amine is CNCCc1cc(F)c(F)c(OCc2cc(C)cc(N)n2)c1.
What is the InChIKey of 6-[[2,3-difluoro-5-[2-(methylamino)ethyl]phenoxy]methyl]-4-methylpyridin-2-amine?
The InChIKey is ZZDNZFBZKZFPJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F2N3O/c1-10-5-12(21-15(19)6-10)9-22-14-8-11(3-4-20-2)7-13(17)16(14)18/h5-8,20H,3-4,9H2,1-2H3,(H2,19,21).
What are the key properties of 6-[[2,3-difluoro-5-[2-(methylamino)ethyl]phenoxy]methyl]-4-methylpyridin-2-amine?
6-[[2,3-difluoro-5-[2-(methylamino)ethyl]phenoxy]methyl]-4-methylpyridin-2-amine has a molecular weight of 307.34 g/mol, XLogP of 2.59, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[2,3-difluoro-5-[2-(methylamino)ethyl]phenoxy]methyl]-4-methylpyridin-2-amine is sourced from PubChem (CID 176515337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).