C21H30FN3 — CID 176517365
2-(cyclohexyliminomethyl)-3-[[(2Z,4E)-3-ethyl-4-fluorohexa-2,4-dien-2-yl]iminomethyl]penta-1,3,4-trien-1-amine (PubChem CID 176517365) has the molecular formula C21H30FN3 and a molecular weight of 343.49 g/mol. Its IUPAC name is 2-(cyclohexyliminomethyl)-3-[[(2Z,4E)-3-ethyl-4-fluorohexa-2,4-dien-2-yl]iminomethyl]penta-1,3,4-trien-1-amine.
| Compound Name | 2-(cyclohexyliminomethyl)-3-[[(2Z,4E)-3-ethyl-4-fluorohexa-2,4-dien-2-yl]iminomethyl]penta-1,3,4-trien-1-amine |
|---|---|
| PubChem CID | 176517365 |
| Molecular Formula | C21H30FN3 |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | 2-(cyclohexyliminomethyl)-3-[[(2Z,4E)-3-ethyl-4-fluorohexa-2,4-dien-2-yl]iminomethyl]penta-1,3,4-trien-1-amine |
| SMILES | C=C=C(/C=N/C(C)=C(CC)\C(F)=C/C)C(=CN)/C=N/C1CCCCC1 |
| InChI | InChI=1S/C21H30FN3/c1-5-17(14-24-16(4)20(6-2)21(22)7-3)18(13-23)15-25-19-11-9-8-10-12-19/h7,13-15,19H,1,6,8-12,23H2,2-4H3/b18-13?,20-16-,21-7+,24-14+,25-15+ |
| InChIKey | DZLZXVSPCMXMSK-CTBVHMDMSA-N |
| XLogP | 5.57 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|