C14H24N6 — CID 176518117
2-(2,3,4,6,7,8-hexahydro-1H-pyrimido[1,2-a]pyrimidin-2-yl)-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidine (PubChem CID 176518117) has the molecular formula C14H24N6 and a molecular weight of 276.39 g/mol. Its IUPAC name is 2-(2,3,4,6,7,8-hexahydro-1H-pyrimido[1,2-a]pyrimidin-2-yl)-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidine.
| Compound Name | 2-(2,3,4,6,7,8-hexahydro-1H-pyrimido[1,2-a]pyrimidin-2-yl)-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 176518117 |
| Molecular Formula | C14H24N6 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 2-(2,3,4,6,7,8-hexahydro-1H-pyrimido[1,2-a]pyrimidin-2-yl)-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidine |
| SMILES | C1CNC2=NC(C3CCN4CCCN=C4N3)CCN2C1 |
| InChI | InChI=1S/C14H24N6/c1-5-15-13-17-11(3-9-19(13)7-1)12-4-10-20-8-2-6-16-14(20)18-12/h11-12H,1-10H2,(H,15,17)(H,16,18) |
| InChIKey | HSZYXUWJPXCCLI-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 55.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |