About 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-nitro-3-(2-oxoethenyl)-1-propan-2-yloxyguanidine
1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-nitro-3-(2-oxoethenyl)-1-propan-2-yloxyguanidine (PubChem CID 176518213) has the molecular formula C10H12ClN5O4S
and a molecular weight of 333.76 g/mol. Its IUPAC name is 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-nitro-3-(2-oxoethenyl)-1-propan-2-yloxyguanidine.
Molecular Properties
| Compound Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-nitro-3-(2-oxoethenyl)-1-propan-2-yloxyguanidine |
| PubChem CID | 176518213 |
| Molecular Formula | C10H12ClN5O4S |
| Molecular Weight | 333.76 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-nitro-3-(2-oxoethenyl)-1-propan-2-yloxyguanidine |
| SMILES | CC(C)ON(Cc1cnc(Cl)s1)C(=N[N+](=O)[O-])NC=C=O |
| InChI | InChI=1S/C10H12ClN5O4S/c1-7(2)20-15(6-8-5-13-9(11)21-8)10(12-3-4-17)14-16(18)19/h3,5,7H,6H2,1-2H3,(H,12,14) |
| InChIKey | MATFIFHHLUEYMP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.76 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-nitro-3-(2-oxoethenyl)-1-propan-2-yloxyguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-nitro-3-(2-oxoethenyl)-1-propan-2-yloxyguanidine?
The IUPAC name of 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-nitro-3-(2-oxoethenyl)-1-propan-2-yloxyguanidine (CID 176518213) is 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-nitro-3-(2-oxoethenyl)-1-propan-2-yloxyguanidine.
What is the SMILES notation for 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-nitro-3-(2-oxoethenyl)-1-propan-2-yloxyguanidine?
The canonical SMILES for 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-nitro-3-(2-oxoethenyl)-1-propan-2-yloxyguanidine is CC(C)ON(Cc1cnc(Cl)s1)C(=N[N+](=O)[O-])NC=C=O.
What is the InChIKey of 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-nitro-3-(2-oxoethenyl)-1-propan-2-yloxyguanidine?
The InChIKey is MATFIFHHLUEYMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClN5O4S/c1-7(2)20-15(6-8-5-13-9(11)21-8)10(12-3-4-17)14-16(18)19/h3,5,7H,6H2,1-2H3,(H,12,14).
What are the key properties of 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-nitro-3-(2-oxoethenyl)-1-propan-2-yloxyguanidine?
1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-nitro-3-(2-oxoethenyl)-1-propan-2-yloxyguanidine has a molecular weight of 333.76 g/mol, XLogP of 1.42, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-nitro-3-(2-oxoethenyl)-1-propan-2-yloxyguanidine is sourced from PubChem (CID 176518213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).