About 1-carbamimidoylguanidine;1-(diaminomethylidene)-2-phenylguanidine
1-carbamimidoylguanidine;1-(diaminomethylidene)-2-phenylguanidine (PubChem CID 176518410) has the molecular formula C10H18N10
and a molecular weight of 278.32 g/mol. Its IUPAC name is 1-carbamimidoylguanidine;1-(diaminomethylidene)-2-phenylguanidine.
Molecular Properties
| Compound Name | 1-carbamimidoylguanidine;1-(diaminomethylidene)-2-phenylguanidine |
| PubChem CID | 176518410 |
| Molecular Formula | C10H18N10 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1-carbamimidoylguanidine;1-(diaminomethylidene)-2-phenylguanidine |
| SMILES | NC(N)=N/C(N)=N/c1ccccc1.[H]/N=C(\N)N/C(N)=N/[H] |
| InChI | InChI=1S/C8H11N5.C2H7N5/c9-7(10)13-8(11)12-6-4-2-1-3-5-6;3-1(4)7-2(5)6/h1-5H,(H6,9,10,11,12,13);(H7,3,4,5,6,7) |
| InChIKey | IEHMEKRIEHTYRZ-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 214.55 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-carbamimidoylguanidine;1-(diaminomethylidene)-2-phenylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-carbamimidoylguanidine;1-(diaminomethylidene)-2-phenylguanidine?
The IUPAC name of 1-carbamimidoylguanidine;1-(diaminomethylidene)-2-phenylguanidine (CID 176518410) is 1-carbamimidoylguanidine;1-(diaminomethylidene)-2-phenylguanidine.
What is the SMILES notation for 1-carbamimidoylguanidine;1-(diaminomethylidene)-2-phenylguanidine?
The canonical SMILES for 1-carbamimidoylguanidine;1-(diaminomethylidene)-2-phenylguanidine is NC(N)=N/C(N)=N/c1ccccc1.[H]/N=C(\N)N/C(N)=N/[H].
What is the InChIKey of 1-carbamimidoylguanidine;1-(diaminomethylidene)-2-phenylguanidine?
The InChIKey is IEHMEKRIEHTYRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5.C2H7N5/c9-7(10)13-8(11)12-6-4-2-1-3-5-6;3-1(4)7-2(5)6/h1-5H,(H6,9,10,11,12,13);(H7,3,4,5,6,7).
What are the key properties of 1-carbamimidoylguanidine;1-(diaminomethylidene)-2-phenylguanidine?
1-carbamimidoylguanidine;1-(diaminomethylidene)-2-phenylguanidine has a molecular weight of 278.32 g/mol, XLogP of -1.73, 1 rotatable bonds, 8 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-carbamimidoylguanidine;1-(diaminomethylidene)-2-phenylguanidine is sourced from PubChem (CID 176518410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).