C10H15N3 — CID 176518440
N-(N-buta-1,3-dien-2-yl-C-methylcarbonimidoyl)-N'-ethenylethanimidamide (PubChem CID 176518440) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is N-(N-buta-1,3-dien-2-yl-C-methylcarbonimidoyl)-N'-ethenylethanimidamide.
| Compound Name | N-(N-buta-1,3-dien-2-yl-C-methylcarbonimidoyl)-N'-ethenylethanimidamide |
|---|---|
| PubChem CID | 176518440 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | N-(N-buta-1,3-dien-2-yl-C-methylcarbonimidoyl)-N'-ethenylethanimidamide |
| SMILES | C=C/N=C(\C)N/C(C)=N/C(=C)C=C |
| InChI | InChI=1S/C10H15N3/c1-6-8(3)12-10(5)13-9(4)11-7-2/h6-7H,1-3H2,4-5H3,(H,11,12,13) |
| InChIKey | APSUBAREAJECRX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|