C23H25ClN4O2 — CID 176518442
N-(8-chloro-2-oxo-1,3,4,5,7,8-hexahydro-1-benzazepin-3-yl)-2-methylimino-2-(1-phenylbuta-2,3-dien-2-ylamino)acetamide (PubChem CID 176518442) has the molecular formula C23H25ClN4O2 and a molecular weight of 424.93 g/mol. Its IUPAC name is N-(8-chloro-2-oxo-1,3,4,5,7,8-hexahydro-1-benzazepin-3-yl)-2-methylimino-2-(1-phenylbuta-2,3-dien-2-ylamino)acetamide.
| Compound Name | N-(8-chloro-2-oxo-1,3,4,5,7,8-hexahydro-1-benzazepin-3-yl)-2-methylimino-2-(1-phenylbuta-2,3-dien-2-ylamino)acetamide |
|---|---|
| PubChem CID | 176518442 |
| Molecular Formula | C23H25ClN4O2 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | N-(8-chloro-2-oxo-1,3,4,5,7,8-hexahydro-1-benzazepin-3-yl)-2-methylimino-2-(1-phenylbuta-2,3-dien-2-ylamino)acetamide |
| SMILES | C=C=C(Cc1ccccc1)N/C(=N\C)C(=O)NC1CCC2=CCC(Cl)C=C2NC1=O |
| InChI | InChI=1S/C23H25ClN4O2/c1-3-18(13-15-7-5-4-6-8-15)26-21(25-2)23(30)27-19-12-10-16-9-11-17(24)14-20(16)28-22(19)29/h4-9,14,17,19H,1,10-13H2,2H3,(H,25,26)(H,27,30)(H,28,29) |
| InChIKey | LERXRJHJOMQDBK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|