C27H40N12O6 — CID 176518841
1-[(E)-[(2E)-2-(diaminomethylidenehydrazinylidene)propylidene]amino]guanidine;1,4-dihydroxy-5,8-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione (PubChem CID 176518841) has the molecular formula C27H40N12O6 and a molecular weight of 628.70 g/mol. Its IUPAC name is 1-[(E)-[(2E)-2-(diaminomethylidenehydrazinylidene)propylidene]amino]guanidine;1,4-dihydroxy-5,8-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione.
| Compound Name | 1-[(E)-[(2E)-2-(diaminomethylidenehydrazinylidene)propylidene]amino]guanidine;1,4-dihydroxy-5,8-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 176518841 |
| Molecular Formula | C27H40N12O6 |
| Molecular Weight | 628.70 g/mol |
| Exact Mass | 628.32 |
| IUPAC Name | 1-[(E)-[(2E)-2-(diaminomethylidenehydrazinylidene)propylidene]amino]guanidine;1,4-dihydroxy-5,8-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione |
| SMILES | O=C1c2c(O)ccc(O)c2C(=O)c2c(NCCNCCO)ccc(NCCNCCO)c21.[H]/N=C(\N)N/N=C/C(C)=N/N=C(N)N |
| InChI | InChI=1S/C22H28N4O6.C5H12N8/c27-11-9-23-5-7-25-13-1-2-14(26-8-6-24-10-12-28)18-17(13)21(31)19-15(29)3-4-16(30)20(19)22(18)32;1-3(11-13-5(8)9)2-10-12-4(6)7/h1-4,23-30H,5-12H2;2H,1H3,(H4,6,7,12)(H4,8,9,13)/b;10-2+,11-3+ |
| InChIKey | RJCIOKFCZLOFCX-CWPRPSLWSA-N |
| XLogP | -2.03 |
| TPSA | 314.20 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.70 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|