C24H40N6 — CID 176519327
(11E)-2,11,20,26-tetramethyl-3,10,14,18,21,25-hexazabicyclo[10.7.7]hexacosa-1(20),2,11,13,18,25-hexaene (PubChem CID 176519327) has the molecular formula C24H40N6 and a molecular weight of 412.63 g/mol. Its IUPAC name is (11E)-2,11,20,26-tetramethyl-3,10,14,18,21,25-hexazabicyclo[10.7.7]hexacosa-1(20),2,11,13,18,25-hexaene.
| Compound Name | (11E)-2,11,20,26-tetramethyl-3,10,14,18,21,25-hexazabicyclo[10.7.7]hexacosa-1(20),2,11,13,18,25-hexaene |
|---|---|
| PubChem CID | 176519327 |
| Molecular Formula | C24H40N6 |
| Molecular Weight | 412.63 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | (11E)-2,11,20,26-tetramethyl-3,10,14,18,21,25-hexazabicyclo[10.7.7]hexacosa-1(20),2,11,13,18,25-hexaene |
| SMILES | CC1=C2/C=N/CCC/N=C\C(=C(\C)NCCCCCC/N=C\2C)\C(C)=N/CCCN1 |
| InChI | InChI=1S/C24H40N6/c1-19-23-17-25-11-9-12-26-18-24(22(4)30-16-10-15-29-21(23)3)20(2)28-14-8-6-5-7-13-27-19/h17-18,27,30H,5-16H2,1-4H3/b23-19+,24-22?,25-17-,26-18+,28-20-,29-21- |
| InChIKey | WFTHPKKGHMZJHK-IQLULNIISA-N |
| XLogP | 4.14 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.63 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |