C10H19N5O6 — CID 176519496
2-carbamimidoyl-1,1-dimethylguanidine;2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one (PubChem CID 176519496) has the molecular formula C10H19N5O6 and a molecular weight of 305.29 g/mol. Its IUPAC name is 2-carbamimidoyl-1,1-dimethylguanidine;2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one.
| Compound Name | 2-carbamimidoyl-1,1-dimethylguanidine;2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one |
|---|---|
| PubChem CID | 176519496 |
| Molecular Formula | C10H19N5O6 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2-carbamimidoyl-1,1-dimethylguanidine;2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one |
| SMILES | O=C1OC(C(O)CO)C(O)=C1O.[H]/N=C(\N)N=C(N)N(C)C |
| InChI | InChI=1S/C6H8O6.C4H11N5/c7-1-2(8)5-3(9)4(10)6(11)12-5;1-9(2)4(7)8-3(5)6/h2,5,7-10H,1H2;1-2H3,(H5,5,6,7,8) |
| InChIKey | GJMMYZATKYNGTJ-UHFFFAOYSA-N |
| XLogP | -2.65 |
| TPSA | 198.71 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|