C11H21N3OS — CID 176519632
5-(7-methoxyheptyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 176519632) has the molecular formula C11H21N3OS and a molecular weight of 243.38 g/mol. Its IUPAC name is 5-(7-methoxyheptyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | 5-(7-methoxyheptyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 176519632 |
| Molecular Formula | C11H21N3OS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 5-(7-methoxyheptyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | [H]/N=C1/NN=C(CCCCCCCOC)CS1 |
| InChI | InChI=1S/C11H21N3OS/c1-15-8-6-4-2-3-5-7-10-9-16-11(12)14-13-10/h2-9H2,1H3,(H2,12,14) |
| InChIKey | DXCUTNVFXPDHMD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 57.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|