C6H14ClN5 — CID 176519754
2-N,2-N,6-trimethyl-1,2-dihydro-1,3,5-triazine-2,4-diamine;hydrochloride (PubChem CID 176519754) has the molecular formula C6H14ClN5 and a molecular weight of 191.67 g/mol. Its IUPAC name is 2-N,2-N,6-trimethyl-1,2-dihydro-1,3,5-triazine-2,4-diamine;hydrochloride.
| Compound Name | 2-N,2-N,6-trimethyl-1,2-dihydro-1,3,5-triazine-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 176519754 |
| Molecular Formula | C6H14ClN5 |
| Molecular Weight | 191.67 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 2-N,2-N,6-trimethyl-1,2-dihydro-1,3,5-triazine-2,4-diamine;hydrochloride |
| SMILES | CC1=NC(N)=NC(N(C)C)N1.Cl |
| InChI | InChI=1S/C6H13N5.ClH/c1-4-8-5(7)10-6(9-4)11(2)3;/h6H,1-3H3,(H3,7,8,9,10);1H |
| InChIKey | BHUPYWHJMWSBOR-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.67 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |