C21H29N5O3 — CID 176519824
N-[(1Z,3E)-1-(4-acetylpiperazin-1-yl)-4-[[2-[ethenyl(methyl)amino]-2-oxoethyl]amino]hepta-1,3,5,6-tetraen-2-yl]prop-2-enamide (PubChem CID 176519824) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is N-[(1Z,3E)-1-(4-acetylpiperazin-1-yl)-4-[[2-[ethenyl(methyl)amino]-2-oxoethyl]amino]hepta-1,3,5,6-tetraen-2-yl]prop-2-enamide.
| Compound Name | N-[(1Z,3E)-1-(4-acetylpiperazin-1-yl)-4-[[2-[ethenyl(methyl)amino]-2-oxoethyl]amino]hepta-1,3,5,6-tetraen-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 176519824 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | N-[(1Z,3E)-1-(4-acetylpiperazin-1-yl)-4-[[2-[ethenyl(methyl)amino]-2-oxoethyl]amino]hepta-1,3,5,6-tetraen-2-yl]prop-2-enamide |
| SMILES | C=C=C/C(=C\C(=C\N1CCN(C(C)=O)CC1)NC(=O)C=C)NCC(=O)N(C)C=C |
| InChI | InChI=1S/C21H29N5O3/c1-6-9-18(22-15-21(29)24(5)8-3)14-19(23-20(28)7-2)16-25-10-12-26(13-11-25)17(4)27/h7-9,14,16,22H,1-3,10-13,15H2,4-5H3,(H,23,28)/b18-14+,19-16- |
| InChIKey | IDFPKCABZLAIQA-RVJCWKLDSA-N |
| XLogP | 0.71 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|