About N-[6-[(N'-methylcarbamimidoyl)amino]hexyl]ethanimidamide;hydrochloride
N-[6-[(N'-methylcarbamimidoyl)amino]hexyl]ethanimidamide;hydrochloride (PubChem CID 176520509) has the molecular formula C10H24ClN5
and a molecular weight of 249.79 g/mol. Its IUPAC name is N-[6-[(N'-methylcarbamimidoyl)amino]hexyl]ethanimidamide;hydrochloride.
Molecular Properties
| Compound Name | N-[6-[(N'-methylcarbamimidoyl)amino]hexyl]ethanimidamide;hydrochloride |
| PubChem CID | 176520509 |
| Molecular Formula | C10H24ClN5 |
| Molecular Weight | 249.79 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | N-[6-[(N'-methylcarbamimidoyl)amino]hexyl]ethanimidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\C)NCCCCCCN/C(N)=N/C |
| InChI | InChI=1S/C10H23N5.ClH/c1-9(11)14-7-5-3-4-6-8-15-10(12)13-2;/h3-8H2,1-2H3,(H2,11,14)(H3,12,13,15);1H |
| InChIKey | AJJCIRNNNHFGEQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.79 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[6-[(N'-methylcarbamimidoyl)amino]hexyl]ethanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-[(N'-methylcarbamimidoyl)amino]hexyl]ethanimidamide;hydrochloride?
The IUPAC name of N-[6-[(N'-methylcarbamimidoyl)amino]hexyl]ethanimidamide;hydrochloride (CID 176520509) is N-[6-[(N'-methylcarbamimidoyl)amino]hexyl]ethanimidamide;hydrochloride.
What is the SMILES notation for N-[6-[(N'-methylcarbamimidoyl)amino]hexyl]ethanimidamide;hydrochloride?
The canonical SMILES for N-[6-[(N'-methylcarbamimidoyl)amino]hexyl]ethanimidamide;hydrochloride is Cl.[H]/N=C(\C)NCCCCCCN/C(N)=N/C.
What is the InChIKey of N-[6-[(N'-methylcarbamimidoyl)amino]hexyl]ethanimidamide;hydrochloride?
The InChIKey is AJJCIRNNNHFGEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N5.ClH/c1-9(11)14-7-5-3-4-6-8-15-10(12)13-2;/h3-8H2,1-2H3,(H2,11,14)(H3,12,13,15);1H.
What are the key properties of N-[6-[(N'-methylcarbamimidoyl)amino]hexyl]ethanimidamide;hydrochloride?
N-[6-[(N'-methylcarbamimidoyl)amino]hexyl]ethanimidamide;hydrochloride has a molecular weight of 249.79 g/mol, XLogP of 1.09, 7 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-[(N'-methylcarbamimidoyl)amino]hexyl]ethanimidamide;hydrochloride is sourced from PubChem (CID 176520509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).