C12H26N6O4S-2 — CID 176520873
bis(piperidine-1-carboximidamide);sulfate (PubChem CID 176520873) has the molecular formula C12H26N6O4S-2 and a molecular weight of 350.45 g/mol. Its IUPAC name is bis(piperidine-1-carboximidamide);sulfate.
| Compound Name | bis(piperidine-1-carboximidamide);sulfate |
|---|---|
| PubChem CID | 176520873 |
| Molecular Formula | C12H26N6O4S-2 |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | bis(piperidine-1-carboximidamide);sulfate |
| SMILES | O=S(=O)([O-])[O-].[H]/N=C(\N)N1CCCCC1.[H]/N=C(\N)N1CCCCC1 |
| InChI | InChI=1S/2C6H13N3.H2O4S/c2*7-6(8)9-4-2-1-3-5-9;1-5(2,3)4/h2*1-5H2,(H3,7,8);(H2,1,2,3,4)/p-2 |
| InChIKey | XEMFKRVIVCQOPE-UHFFFAOYSA-L |
| XLogP | -0.61 |
| TPSA | 186.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|