C3H6ClN5 — CID 176520985
5-chloro-6-imino-1,4-dihydro-1,3,5-triazin-2-amine (PubChem CID 176520985) has the molecular formula C3H6ClN5 and a molecular weight of 147.57 g/mol. Its IUPAC name is 5-chloro-6-imino-1,4-dihydro-1,3,5-triazin-2-amine.
| Compound Name | 5-chloro-6-imino-1,4-dihydro-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 176520985 |
| Molecular Formula | C3H6ClN5 |
| Molecular Weight | 147.57 g/mol |
| Exact Mass | 147.03 |
| IUPAC Name | 5-chloro-6-imino-1,4-dihydro-1,3,5-triazin-2-amine |
| SMILES | [H]/N=C1/NC(N)=NCN1Cl |
| InChI | InChI=1S/C3H6ClN5/c4-9-1-7-2(5)8-3(9)6/h1H2,(H4,5,6,7,8) |
| InChIKey | VJSORNYWLPITHS-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.57 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|