C9H18BrN3OS — CID 176521140
5-(2-butoxyethyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine;hydrobromide (PubChem CID 176521140) has the molecular formula C9H18BrN3OS and a molecular weight of 296.23 g/mol. Its IUPAC name is 5-(2-butoxyethyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine;hydrobromide.
| Compound Name | 5-(2-butoxyethyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine;hydrobromide |
|---|---|
| PubChem CID | 176521140 |
| Molecular Formula | C9H18BrN3OS |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 5-(2-butoxyethyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine;hydrobromide |
| SMILES | Br.[H]/N=C1/NN=C(CCOCCCC)CS1 |
| InChI | InChI=1S/C9H17N3OS.BrH/c1-2-3-5-13-6-4-8-7-14-9(10)12-11-8;/h2-7H2,1H3,(H2,10,12);1H |
| InChIKey | UWDUTIVYPMMWRO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 57.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|