C8H13FN4O — CID 176521204
4-(6-fluoro-2-methyl-1,2-dihydro-1,3,5-triazin-4-yl)morpholine (PubChem CID 176521204) has the molecular formula C8H13FN4O and a molecular weight of 200.22 g/mol. Its IUPAC name is 4-(6-fluoro-2-methyl-1,2-dihydro-1,3,5-triazin-4-yl)morpholine.
| Compound Name | 4-(6-fluoro-2-methyl-1,2-dihydro-1,3,5-triazin-4-yl)morpholine |
|---|---|
| PubChem CID | 176521204 |
| Molecular Formula | C8H13FN4O |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 4-(6-fluoro-2-methyl-1,2-dihydro-1,3,5-triazin-4-yl)morpholine |
| SMILES | CC1N=C(N2CCOCC2)N=C(F)N1 |
| InChI | InChI=1S/C8H13FN4O/c1-6-10-7(9)12-8(11-6)13-2-4-14-5-3-13/h6H,2-5H2,1H3,(H,10,11,12) |
| InChIKey | IJLHHTLJOZRYOB-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|