C10H16N4 — CID 176521303
5,6-dideuterio-4-[2,2,3,3,4,4,5,5,6-nonadeuterio-6-(trideuteriomethyl)piperidin-1-yl]-1H-pyrimidin-2-imine (PubChem CID 176521303) has the molecular formula C10H16N4 and a molecular weight of 206.35 g/mol. Its IUPAC name is 5,6-dideuterio-4-[2,2,3,3,4,4,5,5,6-nonadeuterio-6-(trideuteriomethyl)piperidin-1-yl]-1H-pyrimidin-2-imine.
| Compound Name | 5,6-dideuterio-4-[2,2,3,3,4,4,5,5,6-nonadeuterio-6-(trideuteriomethyl)piperidin-1-yl]-1H-pyrimidin-2-imine |
|---|---|
| PubChem CID | 176521303 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 206.35 g/mol |
| Exact Mass | 206.23 |
| IUPAC Name | 5,6-dideuterio-4-[2,2,3,3,4,4,5,5,6-nonadeuterio-6-(trideuteriomethyl)piperidin-1-yl]-1H-pyrimidin-2-imine |
| SMILES | [H]/N=c1/nc(N2C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C2([2H])C([2H])([2H])[2H])c([2H])c([2H])[nH]1 |
| InChI | InChI=1S/C10H16N4/c1-8-4-2-3-7-14(8)9-5-6-12-10(11)13-9/h5-6,8H,2-4,7H2,1H3,(H2,11,12,13)/i1D3,2D2,3D2,4D2,5D,6D,7D2,8D |
| InChIKey | ZWTYZUPPCZWSKO-BRXLWMBRSA-N |
| XLogP | 1.27 |
| TPSA | 55.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |