About 1-carbamimidoylguanidine;prop-1-ene
1-carbamimidoylguanidine;prop-1-ene (PubChem CID 176521577) has the molecular formula C5H13N5
and a molecular weight of 143.19 g/mol. Its IUPAC name is 1-carbamimidoylguanidine;prop-1-ene.
Molecular Properties
| Compound Name | 1-carbamimidoylguanidine;prop-1-ene |
| PubChem CID | 176521577 |
| Molecular Formula | C5H13N5 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.12 |
| IUPAC Name | 1-carbamimidoylguanidine;prop-1-ene |
| SMILES | C=CC.[H]/N=C(\N)N/C(N)=N/[H] |
| InChI | InChI=1S/C3H6.C2H7N5/c1-3-2;3-1(4)7-2(5)6/h3H,1H2,2H3;(H7,3,4,5,6,7) |
| InChIKey | TWRLARBAWKZYNG-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 111.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-carbamimidoylguanidine;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-carbamimidoylguanidine;prop-1-ene?
The IUPAC name of 1-carbamimidoylguanidine;prop-1-ene (CID 176521577) is 1-carbamimidoylguanidine;prop-1-ene.
What is the SMILES notation for 1-carbamimidoylguanidine;prop-1-ene?
The canonical SMILES for 1-carbamimidoylguanidine;prop-1-ene is C=CC.[H]/N=C(\N)N/C(N)=N/[H].
What is the InChIKey of 1-carbamimidoylguanidine;prop-1-ene?
The InChIKey is TWRLARBAWKZYNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6.C2H7N5/c1-3-2;3-1(4)7-2(5)6/h3H,1H2,2H3;(H7,3,4,5,6,7).
What are the key properties of 1-carbamimidoylguanidine;prop-1-ene?
1-carbamimidoylguanidine;prop-1-ene has a molecular weight of 143.19 g/mol, XLogP of -0.44, 0 rotatable bonds, 5 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-carbamimidoylguanidine;prop-1-ene is sourced from PubChem (CID 176521577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).