C18H23N5O5 — CID 176521778
[(2R,3R,4R,5R)-2-cyano-2-(5-deuterio-4-imino-1H-pyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 2-ethylbutanoate (PubChem CID 176521778) has the molecular formula C18H23N5O5 and a molecular weight of 390.42 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-cyano-2-(5-deuterio-4-imino-1H-pyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 2-ethylbutanoate.
| Compound Name | [(2R,3R,4R,5R)-2-cyano-2-(5-deuterio-4-imino-1H-pyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 2-ethylbutanoate |
|---|---|
| PubChem CID | 176521778 |
| Molecular Formula | C18H23N5O5 |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | [(2R,3R,4R,5R)-2-cyano-2-(5-deuterio-4-imino-1H-pyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 2-ethylbutanoate |
| SMILES | [H]/N=c1\nc[nH]n2c([C@]3(C#N)O[C@H](CO)[C@@H](O)[C@H]3OC(=O)C(CC)CC)cc([2H])c12 |
| InChI | InChI=1S/C18H23N5O5/c1-3-10(4-2)17(26)27-15-14(25)12(7-24)28-18(15,8-19)13-6-5-11-16(20)21-9-22-23(11)13/h5-6,9-10,12,14-15,24-25H,3-4,7H2,1-2H3,(H2,20,21,22)/t12-,14-,15-,18+/m1/s1/i5D |
| InChIKey | IODMBBFHPZIAOW-ARAHLPPLSA-N |
| XLogP | -0.04 |
| TPSA | 156.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |