C12H13N5O4 — CID 176521789
(2R,3S,4R,5S)-5-(5-deuterio-4-imino-1H-pyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(hydroxymethyl)-2-isocyanooxolane-3,4-diol (PubChem CID 176521789) has the molecular formula C12H13N5O4 and a molecular weight of 292.27 g/mol. Its IUPAC name is (2R,3S,4R,5S)-5-(5-deuterio-4-imino-1H-pyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(hydroxymethyl)-2-isocyanooxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5S)-5-(5-deuterio-4-imino-1H-pyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(hydroxymethyl)-2-isocyanooxolane-3,4-diol |
|---|---|
| PubChem CID | 176521789 |
| Molecular Formula | C12H13N5O4 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | (2R,3S,4R,5S)-5-(5-deuterio-4-imino-1H-pyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(hydroxymethyl)-2-isocyanooxolane-3,4-diol |
| SMILES | [H]/N=c1\nc[nH]n2c([C@@H]3O[C@@](CO)([N+]#[C-])[C@@H](O)[C@H]3O)cc([2H])c12 |
| InChI | InChI=1S/C12H13N5O4/c1-14-12(4-18)10(20)8(19)9(21-12)6-2-3-7-11(13)15-5-16-17(6)7/h2-3,5,8-10,18-20H,4H2,(H2,13,15,16)/t8-,9-,10-,12+/m0/s1/i3D |
| InChIKey | UUHTUEGHFJWBLZ-PEINGPFUSA-N |
| XLogP | -1.46 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|