C17H19FN2O5 — CID 176521852
[(3aR,4R,6R,6aR)-4-(6-fluoroindazol-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl acetate (PubChem CID 176521852) has the molecular formula C17H19FN2O5 and a molecular weight of 350.35 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-(6-fluoroindazol-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl acetate.
| Compound Name | [(3aR,4R,6R,6aR)-4-(6-fluoroindazol-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl acetate |
|---|---|
| PubChem CID | 176521852 |
| Molecular Formula | C17H19FN2O5 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-(6-fluoroindazol-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2ncc3ccc(F)cc32)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C17H19FN2O5/c1-9(21)22-8-13-14-15(25-17(2,3)24-14)16(23-13)20-12-6-11(18)5-4-10(12)7-19-20/h4-7,13-16H,8H2,1-3H3/t13-,14-,15-,16-/m1/s1 |
| InChIKey | WFDRZAQBSVMYQA-KLHDSHLOSA-N |
| XLogP | 2.16 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |