C15H10F2N2O2 — CID 176522399
methyl 2-diazo-2-[3-(2,4-difluorophenyl)phenyl]acetate (PubChem CID 176522399) has the molecular formula C15H10F2N2O2 and a molecular weight of 288.25 g/mol. Its IUPAC name is methyl 2-diazo-2-[3-(2,4-difluorophenyl)phenyl]acetate.
| Compound Name | methyl 2-diazo-2-[3-(2,4-difluorophenyl)phenyl]acetate |
|---|---|
| PubChem CID | 176522399 |
| Molecular Formula | C15H10F2N2O2 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | methyl 2-diazo-2-[3-(2,4-difluorophenyl)phenyl]acetate |
| SMILES | COC(=O)C(=[N+]=[N-])c1cccc(-c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C15H10F2N2O2/c1-21-15(20)14(19-18)10-4-2-3-9(7-10)12-6-5-11(16)8-13(12)17/h2-8H,1H3 |
| InChIKey | JJQSIKWGOIWVOP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|