C17H14INO4 — CID 176522444
methyl 1-(3-iodophenyl)-6-methoxy-3-oxo-2H-isoindole-1-carboxylate (PubChem CID 176522444) has the molecular formula C17H14INO4 and a molecular weight of 423.21 g/mol. Its IUPAC name is methyl 1-(3-iodophenyl)-6-methoxy-3-oxo-2H-isoindole-1-carboxylate.
| Compound Name | methyl 1-(3-iodophenyl)-6-methoxy-3-oxo-2H-isoindole-1-carboxylate |
|---|---|
| PubChem CID | 176522444 |
| Molecular Formula | C17H14INO4 |
| Molecular Weight | 423.21 g/mol |
| Exact Mass | 423.00 |
| IUPAC Name | methyl 1-(3-iodophenyl)-6-methoxy-3-oxo-2H-isoindole-1-carboxylate |
| SMILES | COC(=O)C1(c2cccc(I)c2)NC(=O)c2ccc(OC)cc21 |
| InChI | InChI=1S/C17H14INO4/c1-22-12-6-7-13-14(9-12)17(16(21)23-2,19-15(13)20)10-4-3-5-11(18)8-10/h3-9H,1-2H3,(H,19,20) |
| InChIKey | RJXSBUXRPWHVSB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.21 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|