C8H9N — CID 176522524
5-ethenylidenecyclohexa-1,3-dien-1-amine (PubChem CID 176522524) has the molecular formula C8H9N and a molecular weight of 119.17 g/mol. Its IUPAC name is 5-ethenylidenecyclohexa-1,3-dien-1-amine.
| Compound Name | 5-ethenylidenecyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 176522524 |
| Molecular Formula | C8H9N |
| Molecular Weight | 119.17 g/mol |
| Exact Mass | 119.07 |
| IUPAC Name | 5-ethenylidenecyclohexa-1,3-dien-1-amine |
| SMILES | C=C=C1C=CC=C(N)C1 |
| InChI | InChI=1S/C8H9N/c1-2-7-4-3-5-8(9)6-7/h3-5H,1,6,9H2 |
| InChIKey | QOMPSMUMXYVJRW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.17 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |