C7H10F3N5 — CID 176522710
N-(N-amino-N-prop-2-ynylcarbamimidoyl)-2,2,2-trifluoro-N'-methylethanimidamide (PubChem CID 176522710) has the molecular formula C7H10F3N5 and a molecular weight of 221.19 g/mol. Its IUPAC name is N-(N-amino-N-prop-2-ynylcarbamimidoyl)-2,2,2-trifluoro-N'-methylethanimidamide.
| Compound Name | N-(N-amino-N-prop-2-ynylcarbamimidoyl)-2,2,2-trifluoro-N'-methylethanimidamide |
|---|---|
| PubChem CID | 176522710 |
| Molecular Formula | C7H10F3N5 |
| Molecular Weight | 221.19 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | N-(N-amino-N-prop-2-ynylcarbamimidoyl)-2,2,2-trifluoro-N'-methylethanimidamide |
| SMILES | [H]/N=C(/N/C(=N/C)C(F)(F)F)N(N)CC#C |
| InChI | InChI=1S/C7H10F3N5/c1-3-4-15(12)6(11)14-5(13-2)7(8,9)10/h1H,4,12H2,2H3,(H2,11,13,14) |
| InChIKey | NVQXUQPGNYZPAX-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.19 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|