About N-(N'-propylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide
N-(N'-propylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide (PubChem CID 176522969) has the molecular formula C10H19N5
and a molecular weight of 209.30 g/mol. Its IUPAC name is N-(N'-propylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide.
Molecular Properties
| Compound Name | N-(N'-propylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide |
| PubChem CID | 176522969 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | N-(N'-propylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide |
| SMILES | [H]/N=C(\N/C(N)=N/CCC)N1CC=CCC1 |
| InChI | InChI=1S/C10H19N5/c1-2-6-13-9(11)14-10(12)15-7-4-3-5-8-15/h3-4H,2,5-8H2,1H3,(H4,11,12,13,14) |
| InChIKey | ZFLRBIZGILZTDO-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(N'-propylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(N'-propylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide?
The IUPAC name of N-(N'-propylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide (CID 176522969) is N-(N'-propylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide.
What is the SMILES notation for N-(N'-propylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide?
The canonical SMILES for N-(N'-propylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide is [H]/N=C(\N/C(N)=N/CCC)N1CC=CCC1.
What is the InChIKey of N-(N'-propylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide?
The InChIKey is ZFLRBIZGILZTDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N5/c1-2-6-13-9(11)14-10(12)15-7-4-3-5-8-15/h3-4H,2,5-8H2,1H3,(H4,11,12,13,14).
What are the key properties of N-(N'-propylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide?
N-(N'-propylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide has a molecular weight of 209.30 g/mol, XLogP of 0.50, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(N'-propylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide is sourced from PubChem (CID 176522969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).