C20H41N7 — CID 176523114
2-[1-(3-aminopropylamino)propan-2-yliminomethylideneamino]-2-methyl-N'-(2,2,6,6-tetramethylpiperidin-4-yl)propanimidamide (PubChem CID 176523114) has the molecular formula C20H41N7 and a molecular weight of 379.60 g/mol. Its IUPAC name is 2-[1-(3-aminopropylamino)propan-2-yliminomethylideneamino]-2-methyl-N'-(2,2,6,6-tetramethylpiperidin-4-yl)propanimidamide.
| Compound Name | 2-[1-(3-aminopropylamino)propan-2-yliminomethylideneamino]-2-methyl-N'-(2,2,6,6-tetramethylpiperidin-4-yl)propanimidamide |
|---|---|
| PubChem CID | 176523114 |
| Molecular Formula | C20H41N7 |
| Molecular Weight | 379.60 g/mol |
| Exact Mass | 379.34 |
| IUPAC Name | 2-[1-(3-aminopropylamino)propan-2-yliminomethylideneamino]-2-methyl-N'-(2,2,6,6-tetramethylpiperidin-4-yl)propanimidamide |
| SMILES | CC(CNCCCN)N=C=NC(C)(C)/C(N)=N/C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C20H41N7/c1-15(13-23-10-8-9-21)24-14-25-20(6,7)17(22)26-16-11-18(2,3)27-19(4,5)12-16/h15-16,23,27H,8-13,21H2,1-7H3,(H2,22,26) |
| InChIKey | RHBGSZFUJOGWPP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.60 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|