C10H19N5 — CID 176523233
4-N,4-N,6,6-tetramethyl-2-N-prop-2-enyl-1H-1,3,5-triazine-2,4-diamine (PubChem CID 176523233) has the molecular formula C10H19N5 and a molecular weight of 209.30 g/mol. Its IUPAC name is 4-N,4-N,6,6-tetramethyl-2-N-prop-2-enyl-1H-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N,4-N,6,6-tetramethyl-2-N-prop-2-enyl-1H-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 176523233 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 4-N,4-N,6,6-tetramethyl-2-N-prop-2-enyl-1H-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCNC1=NC(N(C)C)=NC(C)(C)N1 |
| InChI | InChI=1S/C10H19N5/c1-6-7-11-8-12-9(15(4)5)14-10(2,3)13-8/h6H,1,7H2,2-5H3,(H2,11,12,13,14) |
| InChIKey | AMNGTWIHWANZNG-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|