About N-[N'-[2-deuterio-2-(2,5-dideuteriophenyl)ethyl]carbamimidoyl]ethanimidamide
N-[N'-[2-deuterio-2-(2,5-dideuteriophenyl)ethyl]carbamimidoyl]ethanimidamide (PubChem CID 176523377) has the molecular formula C11H16N4
and a molecular weight of 207.30 g/mol. Its IUPAC name is N-[N'-[2-deuterio-2-(2,5-dideuteriophenyl)ethyl]carbamimidoyl]ethanimidamide.
Molecular Properties
| Compound Name | N-[N'-[2-deuterio-2-(2,5-dideuteriophenyl)ethyl]carbamimidoyl]ethanimidamide |
| PubChem CID | 176523377 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | N-[N'-[2-deuterio-2-(2,5-dideuteriophenyl)ethyl]carbamimidoyl]ethanimidamide |
| SMILES | [H]/N=C(\C)N/C(N)=N/CC([2H])c1cc([2H])ccc1[2H] |
| InChI | InChI=1S/C11H16N4/c1-9(12)15-11(13)14-8-7-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H4,12,13,14,15)/i3D,6D,7D |
| InChIKey | RHNOFMBNSFLJPW-YXAOJZFASA-N |
| XLogP | 1.13 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[N'-[2-deuterio-2-(2,5-dideuteriophenyl)ethyl]carbamimidoyl]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[N'-[2-deuterio-2-(2,5-dideuteriophenyl)ethyl]carbamimidoyl]ethanimidamide?
The IUPAC name of N-[N'-[2-deuterio-2-(2,5-dideuteriophenyl)ethyl]carbamimidoyl]ethanimidamide (CID 176523377) is N-[N'-[2-deuterio-2-(2,5-dideuteriophenyl)ethyl]carbamimidoyl]ethanimidamide.
What is the SMILES notation for N-[N'-[2-deuterio-2-(2,5-dideuteriophenyl)ethyl]carbamimidoyl]ethanimidamide?
The canonical SMILES for N-[N'-[2-deuterio-2-(2,5-dideuteriophenyl)ethyl]carbamimidoyl]ethanimidamide is [H]/N=C(\C)N/C(N)=N/CC([2H])c1cc([2H])ccc1[2H].
What is the InChIKey of N-[N'-[2-deuterio-2-(2,5-dideuteriophenyl)ethyl]carbamimidoyl]ethanimidamide?
The InChIKey is RHNOFMBNSFLJPW-YXAOJZFASA-N. The full InChI is InChI=1S/C11H16N4/c1-9(12)15-11(13)14-8-7-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H4,12,13,14,15)/i3D,6D,7D.
What are the key properties of N-[N'-[2-deuterio-2-(2,5-dideuteriophenyl)ethyl]carbamimidoyl]ethanimidamide?
N-[N'-[2-deuterio-2-(2,5-dideuteriophenyl)ethyl]carbamimidoyl]ethanimidamide has a molecular weight of 207.30 g/mol, XLogP of 1.13, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[N'-[2-deuterio-2-(2,5-dideuteriophenyl)ethyl]carbamimidoyl]ethanimidamide is sourced from PubChem (CID 176523377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).