C14H23N5 — CID 176523672
N-[amino-[[(2E,4Z)-hepta-2,4,6-trien-3-yl]amino]methylidene]piperidine-1-carboximidamide (PubChem CID 176523672) has the molecular formula C14H23N5 and a molecular weight of 261.37 g/mol. Its IUPAC name is N-[amino-[[(2E,4Z)-hepta-2,4,6-trien-3-yl]amino]methylidene]piperidine-1-carboximidamide.
| Compound Name | N-[amino-[[(2E,4Z)-hepta-2,4,6-trien-3-yl]amino]methylidene]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 176523672 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | N-[amino-[[(2E,4Z)-hepta-2,4,6-trien-3-yl]amino]methylidene]piperidine-1-carboximidamide |
| SMILES | [H]/N=C(\N=C(N)NC(/C=C\C=C)=C/C)N1CCCCC1 |
| InChI | InChI=1S/C14H23N5/c1-3-5-9-12(4-2)17-13(15)18-14(16)19-10-7-6-8-11-19/h3-5,9H,1,6-8,10-11H2,2H3,(H4,15,16,17,18)/b9-5-,12-4+ |
| InChIKey | YEBNBBQTVXZDNL-WQPWRAGBSA-N |
| XLogP | 1.96 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|