C19H34N6 — CID 176524081
3-N-(4-ethenyl-1-methylpiperidin-4-yl)-2-N-[3-(3-hydrazinylprop-1-en-2-ylamino)prop-1-en-2-yl]penta-3,4-diene-2,3-diamine (PubChem CID 176524081) has the molecular formula C19H34N6 and a molecular weight of 346.52 g/mol. Its IUPAC name is 3-N-(4-ethenyl-1-methylpiperidin-4-yl)-2-N-[3-(3-hydrazinylprop-1-en-2-ylamino)prop-1-en-2-yl]penta-3,4-diene-2,3-diamine.
| Compound Name | 3-N-(4-ethenyl-1-methylpiperidin-4-yl)-2-N-[3-(3-hydrazinylprop-1-en-2-ylamino)prop-1-en-2-yl]penta-3,4-diene-2,3-diamine |
|---|---|
| PubChem CID | 176524081 |
| Molecular Formula | C19H34N6 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.28 |
| IUPAC Name | 3-N-(4-ethenyl-1-methylpiperidin-4-yl)-2-N-[3-(3-hydrazinylprop-1-en-2-ylamino)prop-1-en-2-yl]penta-3,4-diene-2,3-diamine |
| SMILES | C=C=C(NC1(C=C)CCN(C)CC1)C(C)NC(=C)CNC(=C)CNN |
| InChI | InChI=1S/C19H34N6/c1-7-18(24-19(8-2)9-11-25(6)12-10-19)17(5)23-16(4)13-21-15(3)14-22-20/h8,17,21-24H,1-4,9-14,20H2,5-6H3 |
| InChIKey | DXYBIEKRBJNOJS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|