About 2-oxa-3,9-diazabicyclo[4.3.0]nona-1(6),3,4-trien-8-one
2-oxa-3,9-diazabicyclo[4.3.0]nona-1(6),3,4-trien-8-one (PubChem CID 176524082) has the molecular formula C6H4N2O2
and a molecular weight of 136.11 g/mol. Its IUPAC name is 2-oxa-3,9-diazabicyclo[4.3.0]nona-1(6),3,4-trien-8-one.
Analyze 2-oxa-3,9-diazabicyclo[4.3.0]nona-1(6),3,4-trien-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxa-3,9-diazabicyclo[4.3.0]nona-1(6),3,4-trien-8-one?
The IUPAC name of 2-oxa-3,9-diazabicyclo[4.3.0]nona-1(6),3,4-trien-8-one (CID 176524082) is 2-oxa-3,9-diazabicyclo[4.3.0]nona-1(6),3,4-trien-8-one.
What is the SMILES notation for 2-oxa-3,9-diazabicyclo[4.3.0]nona-1(6),3,4-trien-8-one?
The canonical SMILES for 2-oxa-3,9-diazabicyclo[4.3.0]nona-1(6),3,4-trien-8-one is O=C1CC2=C(N1)ON=C=C2.
What is the InChIKey of 2-oxa-3,9-diazabicyclo[4.3.0]nona-1(6),3,4-trien-8-one?
The InChIKey is XVYMUYOHQYJPFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O2/c9-5-3-4-1-2-7-10-6(4)8-5/h1H,3H2,(H,8,9).
What are the key properties of 2-oxa-3,9-diazabicyclo[4.3.0]nona-1(6),3,4-trien-8-one?
2-oxa-3,9-diazabicyclo[4.3.0]nona-1(6),3,4-trien-8-one has a molecular weight of 136.11 g/mol, XLogP of -0.11, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxa-3,9-diazabicyclo[4.3.0]nona-1(6),3,4-trien-8-one is sourced from PubChem (CID 176524082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).