C11H24N6 — CID 176524139
1-(4-carbamimidamidobutyl)-2-(3-methylbut-2-enyl)guanidine (PubChem CID 176524139) has the molecular formula C11H24N6 and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-(4-carbamimidamidobutyl)-2-(3-methylbut-2-enyl)guanidine.
| Compound Name | 1-(4-carbamimidamidobutyl)-2-(3-methylbut-2-enyl)guanidine |
|---|---|
| PubChem CID | 176524139 |
| Molecular Formula | C11H24N6 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 1-(4-carbamimidamidobutyl)-2-(3-methylbut-2-enyl)guanidine |
| SMILES | [H]/N=C(\N)NCCCCN/C(N)=N/CC=C(C)C |
| InChI | InChI=1S/C11H24N6/c1-9(2)5-8-17-11(14)16-7-4-3-6-15-10(12)13/h5H,3-4,6-8H2,1-2H3,(H4,12,13,15)(H3,14,16,17) |
| InChIKey | CQWDNBZZMTWKGD-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|