C26H31N7O2 — CID 176524190
2-methanimidoyl-N-[2-methyl-5-[2-oxo-1-(2-pyrrolidin-1-ylethylamino)ethenyl]phenyl]-4-[1-(1-methylpyrazol-4-yl)ethenylimino]but-2-enamide (PubChem CID 176524190) has the molecular formula C26H31N7O2 and a molecular weight of 473.58 g/mol. Its IUPAC name is 2-methanimidoyl-N-[2-methyl-5-[2-oxo-1-(2-pyrrolidin-1-ylethylamino)ethenyl]phenyl]-4-[1-(1-methylpyrazol-4-yl)ethenylimino]but-2-enamide.
| Compound Name | 2-methanimidoyl-N-[2-methyl-5-[2-oxo-1-(2-pyrrolidin-1-ylethylamino)ethenyl]phenyl]-4-[1-(1-methylpyrazol-4-yl)ethenylimino]but-2-enamide |
|---|---|
| PubChem CID | 176524190 |
| Molecular Formula | C26H31N7O2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | 2-methanimidoyl-N-[2-methyl-5-[2-oxo-1-(2-pyrrolidin-1-ylethylamino)ethenyl]phenyl]-4-[1-(1-methylpyrazol-4-yl)ethenylimino]but-2-enamide |
| SMILES | [H]/N=C/C(=C/C=N/C(=C)c1cnn(C)c1)C(=O)Nc1cc(C(=C=O)NCCN2CCCC2)ccc1C |
| InChI | InChI=1S/C26H31N7O2/c1-19-6-7-21(25(18-34)29-10-13-33-11-4-5-12-33)14-24(19)31-26(35)22(15-27)8-9-28-20(2)23-16-30-32(3)17-23/h6-9,14-17,27,29H,2,4-5,10-13H2,1,3H3,(H,31,35)/b22-8?,27-15+,28-9+ |
| InChIKey | PJBTVSRASUIVFL-AZNAUNAJSA-N |
| XLogP | 2.84 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|