About 6-methyl-4,7-dihydro-3H-purine
6-methyl-4,7-dihydro-3H-purine (PubChem CID 176524374) has the molecular formula C6H8N4
and a molecular weight of 136.16 g/mol. Its IUPAC name is 6-methyl-4,7-dihydro-3H-purine.
Molecular Properties
| Compound Name | 6-methyl-4,7-dihydro-3H-purine |
| PubChem CID | 176524374 |
| Molecular Formula | C6H8N4 |
| Molecular Weight | 136.16 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 6-methyl-4,7-dihydro-3H-purine |
| SMILES | CC1=C2NC=NC2NC=N1 |
| InChI | InChI=1S/C6H8N4/c1-4-5-6(9-2-7-4)10-3-8-5/h2-3,6H,1H3,(H,7,9)(H,8,10) |
| InChIKey | MVAGXKRLARIGCL-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.16 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methyl-4,7-dihydro-3H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-4,7-dihydro-3H-purine?
The IUPAC name of 6-methyl-4,7-dihydro-3H-purine (CID 176524374) is 6-methyl-4,7-dihydro-3H-purine.
What is the SMILES notation for 6-methyl-4,7-dihydro-3H-purine?
The canonical SMILES for 6-methyl-4,7-dihydro-3H-purine is CC1=C2NC=NC2NC=N1.
What is the InChIKey of 6-methyl-4,7-dihydro-3H-purine?
The InChIKey is MVAGXKRLARIGCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4/c1-4-5-6(9-2-7-4)10-3-8-5/h2-3,6H,1H3,(H,7,9)(H,8,10).
What are the key properties of 6-methyl-4,7-dihydro-3H-purine?
6-methyl-4,7-dihydro-3H-purine has a molecular weight of 136.16 g/mol, XLogP of -0.19, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-4,7-dihydro-3H-purine is sourced from PubChem (CID 176524374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).