About (5-amino-4-ethoxy-1,2-dihydropyrazol-3-ylidene)methanone
(5-amino-4-ethoxy-1,2-dihydropyrazol-3-ylidene)methanone (PubChem CID 176524572) has the molecular formula C6H9N3O2
and a molecular weight of 155.16 g/mol. Its IUPAC name is (5-amino-4-ethoxy-1,2-dihydropyrazol-3-ylidene)methanone.
Molecular Properties
| Compound Name | (5-amino-4-ethoxy-1,2-dihydropyrazol-3-ylidene)methanone |
| PubChem CID | 176524572 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | (5-amino-4-ethoxy-1,2-dihydropyrazol-3-ylidene)methanone |
| SMILES | CCOC1=C(N)NNC1=C=O |
| InChI | InChI=1S/C6H9N3O2/c1-2-11-5-4(3-10)8-9-6(5)7/h8-9H,2,7H2,1H3 |
| InChIKey | GMPVIIWBDQRBQE-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze (5-amino-4-ethoxy-1,2-dihydropyrazol-3-ylidene)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-amino-4-ethoxy-1,2-dihydropyrazol-3-ylidene)methanone?
The IUPAC name of (5-amino-4-ethoxy-1,2-dihydropyrazol-3-ylidene)methanone (CID 176524572) is (5-amino-4-ethoxy-1,2-dihydropyrazol-3-ylidene)methanone.
What is the SMILES notation for (5-amino-4-ethoxy-1,2-dihydropyrazol-3-ylidene)methanone?
The canonical SMILES for (5-amino-4-ethoxy-1,2-dihydropyrazol-3-ylidene)methanone is CCOC1=C(N)NNC1=C=O.
What is the InChIKey of (5-amino-4-ethoxy-1,2-dihydropyrazol-3-ylidene)methanone?
The InChIKey is GMPVIIWBDQRBQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O2/c1-2-11-5-4(3-10)8-9-6(5)7/h8-9H,2,7H2,1H3.
What are the key properties of (5-amino-4-ethoxy-1,2-dihydropyrazol-3-ylidene)methanone?
(5-amino-4-ethoxy-1,2-dihydropyrazol-3-ylidene)methanone has a molecular weight of 155.16 g/mol, XLogP of -1.03, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-amino-4-ethoxy-1,2-dihydropyrazol-3-ylidene)methanone is sourced from PubChem (CID 176524572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).